A1110550
Thiocarbohydrazide , 98% , 2231-57-4
Synonym(s):
Thiocarbonyldihydrazide
CAS NO.：2231-57-4
Empirical Formula: CH6N4S
Molecular Weight: 106.15
MDL number: MFCD00007616
EINECS: 218-769-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25g | RMB32.00 | In Stock |
|
| 100g | RMB86.40 | In Stock |
|
| 500g | RMB317.60 | In Stock |
|
| 2.5kg | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-174 °C (dec.)(lit.) |
| Boiling point: | 230.1±23.0 °C(Predicted) |
| Density | 1.273 (estimate) |
| refractive index | 1.5605 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Very slightly soluble (0.5g/100g, 25°C). Insoluble in ether. |
| pka | 10.58±0.70(Predicted) |
| form | Crystalline Powder |
| color | White to gray-beige |
| Sensitive | Light Sensitive |
| BRN | 506657 |
| InChI | InChI=1S/CH6N4S/c2-4-1(6)5-3/h2-3H2,(H2,4,5,6) |
| InChIKey | LJTFFORYSFGNCT-UHFFFAOYSA-N |
| SMILES | C(=S)(NN)NN |
| CAS DataBase Reference | 2231-57-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Carbonothioic dihydrazide(2231-57-4) |
| EPA Substance Registry System | Thiocarbazide (2231-57-4) |
Description and Uses
Thiocarbohydrazide is used in electron microscopy to produce electron-opaque deposits for ultra structural analysis. It is used in the synthesis of oxazine grass ketones.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H330-H311 |
| Precautionary statements | P260-P264-P270-P280-P302+P352+P312-P304+P340+P310 |
| Hazard Codes | T+ |
| Risk Statements | 5-26/28-36/38-21 |
| Safety Statements | 28-36/37/39-45-38-36/37-28A-1 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | FF2975000 |
| F | 4.4-8 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | I |
| HS Code | 29309090 |
| Hazardous Substances Data | 2231-57-4(Hazardous Substances Data) |
