A1176450
Bisoctyldimethylammoniumchloride , ~ 80%(20%ethanol water solution) , 5538-94-3
CAS NO.:5538-94-3
Empirical Formula: C18H40ClN
Molecular Weight: 305.97
MDL number: MFCD01711139
EINECS: 226-901-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25g | RMB73.60 | In Stock |
|
| 100g | RMB223.20 | In Stock |
|
| 500g | RMB741.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75 °C |
| Boiling point: | 208.52℃[at 101 325 Pa] |
| Density | 0.926[at 20℃] |
| vapor pressure | 0.001Pa at 20℃ |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Colourless to Off-White |
| Water Solubility | 250mg/L at 25℃ |
| InChI | InChI=1S/C18H40N.ClH/c1-5-7-9-11-13-15-17-19(3,4)18-16-14-12-10-8-6-2;/h5-18H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FARBQUXLIQOIDY-UHFFFAOYSA-M |
| SMILES | [N+](C)(C)(CCCCCCCC)CCCCCCCC.[Cl-] |
| LogP | 0.1 at 21℃ |
| CAS DataBase Reference | 5538-94-3(CAS DataBase Reference) |
| EPA Substance Registry System | Dimethyl dioctyl ammonium chloride (5538-94-3) |
Description and Uses
Bardac(R) LF is a quaternary ammonium based antimicrobial used as a bacteriostat, disinfectant and/or a microbiocide. Bardac(R) LF is ideal for recirculating water systems where control of undesirable microbes without excessive foam is essential.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS09,GHS06 |
| Signal word | Danger |
| Hazard statements | H314-H318-H400-H310-H301-H410 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501-P280-P305+P351+P338-P310-P264-P270-P301+P310-P321-P330-P405-P501-P273-P391-P501-P273-P391-P501-P262-P264-P270-P280-P302+P350-P310-P322-P361-P363-P405-P501 |
| RIDADR | 2810 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29239000 |








