A1181512
3,5-Bis(trifluoromethyl)benzaldehyde , 97% , 401-95-6
CAS NO.:401-95-6
Empirical Formula: C9H4F6O
Molecular Weight: 242.12
MDL number: MFCD00010206
EINECS: 202-860-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB40.00 | In Stock |
|
| 25G | RMB148.80 | In Stock |
|
| 100G | RMB464.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 37 °C1.3 mm Hg(lit.) |
| Density | 1.469 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 158 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.469 |
| color | Clear colorless to yellow |
| Water Solubility | Insoluble in water. Soluble in many organic solvents. |
| Sensitive | Air Sensitive |
| BRN | 1884058 |
| InChI | InChI=1S/C9H4F6O/c10-8(11,12)6-1-5(4-16)2-7(3-6)9(13,14)15/h1-4H |
| InChIKey | LDWLIXZSDPXYDR-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 401-95-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)benzaldehyde(401-95-6) |
Description and Uses
3,5-Bis(trifluoromethyl)benzaldehyde was used in the synthesis of a series of meso-3,5-bis(trifluoromethyl)phenyl-substituted expanded porphyrins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | IRRITANT |
| HS Code | 29124990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




