A1182312
4-Bromo-2-methylaniline , 98% , 583-75-5
Synonym(s):
2-Amino-5-bromotoluene;4-Bromo-o-toluidine
CAS NO.：583-75-5
Empirical Formula: C7H8BrN
Molecular Weight: 186.05
MDL number: MFCD00007825
EINECS: 209-519-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB68.00 | In Stock |
|
| 100G | RMB163.20 | In Stock |
|
| 500g | RMB871.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-59 °C(lit.) |
| Boiling point: | 240 °C(lit.) |
| Density | 1.4700 (rough estimate) |
| refractive index | 1.6190 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 3.75±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light red to Green |
| BRN | 636521 |
| InChI | InChI=1S/C7H8BrN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
| InChIKey | PCHYYOCUCGCSBU-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(Br)C=C1C |
| CAS DataBase Reference | 583-75-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4-bromo-2-methyl-(583-75-5) |
| EPA Substance Registry System | Benzenamine, 4-bromo-2-methyl- (583-75-5) |
Description and Uses
4-Bromo-2-methylaniline was used in the preparation of 4-Bromo-2-methylphenol.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-33 |
| Safety Statements | 26-37/39-24/25 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| RTECS | XU4250000 |
| Hazard Note | Harmful |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
