A1186012
5-Bromo-thiazol-2-ylamine , 97% , 61296-22-8
CAS NO.：61296-22-8
Empirical Formula: C3H4Br2N2S
Molecular Weight: 259.95
MDL number: MFCD00012712
EINECS: 262-699-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB106.40 | In Stock |
|
| 100G | RMB395.20 | In Stock |
|
| 500G | RMB1584.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | Light yellow to light brown |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C3H3BrN2S.BrH/c4-2-1-6-3(5)7-2;/h1H,(H2,5,6);1H |
| InChIKey | NUSVDASTCPBUIP-UHFFFAOYSA-N |
| SMILES | C1(Br)=CN=C(N)S1.Br |
| CAS DataBase Reference | 61296-22-8(CAS DataBase Reference) |
Description and Uses
2-Amino-5-bromothiazole monohydrobromide was used in the preparation of N-(5-Bromo-2-thiazolyl)-2-acetylamino-2-ethoxycarbonyl-3-(2-furyl)-propanamide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H302-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36 |
| Safety Statements | 26-36/37-24/25 |
| WGK Germany | 3 |
| RTECS | XJ1262200 |
| HS Code | 29341000 |
