A1187912
2-Benzimidazolemethanol , 97% , 4856-97-7
CAS NO.:4856-97-7
Empirical Formula: C8H8N2O
Molecular Weight: 148.16
MDL number: MFCD00014560
EINECS: 225-451-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB78.40 | In Stock |
|
| 25G | RMB267.20 | In Stock |
|
| 100G | RMB890.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-175 °C (lit.) |
| Boiling point: | 268.75°C (rough estimate) |
| Density | 1.1828 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 11.57±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white to light brown |
| InChI | InChI=1S/C8H8N2O/c11-5-8-9-6-3-1-2-4-7(6)10-8/h1-4,11H,5H2,(H,9,10) |
| InChIKey | IAJLTMBBAVVMQO-UHFFFAOYSA-N |
| SMILES | C1(CO)NC2=CC=CC=C2N=1 |
| CAS DataBase Reference | 4856-97-7(CAS DataBase Reference) |
Description and Uses
2-Benzimidazolemethanol was used in the preparation of 2-(chloromethyl)-1-(methylsulfonyl)benzimidazole via methanesulfonylation. It was also used in the synthesis of 1H-benzimidazol-2-ylmethyl diethyl phosphate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



