A1189550
2,4-DB-methylester , Analysis standard , 94-82-6
Synonym(s):
2,4-DB;4-(2,4-Dichlorophenoxy)butyric acid
CAS NO.:94-82-6
Empirical Formula: C10H10Cl2O3
Molecular Weight: 249.09
MDL number: MFCD00002819
EINECS: 202-366-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB343.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-120 °C(lit.) |
| Boiling point: | 324.35 °C |
| Density | 1.3342 (estimate) |
| storage temp. | 0-6°C |
| pka | 4.56±0.10(Predicted) |
| form | Amorphous Powder |
| color | Off-white |
| Water Solubility | 53mg/L(room temperature) |
| Merck | 13,2855 |
| BRN | 1976809 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C10H10Cl2O3/c11-7-3-4-9(8(12)6-7)15-5-1-2-10(13)14/h3-4,6H,1-2,5H2,(H,13,14) |
| InChIKey | YIVXMZJTEQBPQO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCOC1=CC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 94-82-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Butanoic acid, 4-(2,4-dichlorophenoxy)-(94-82-6) |
| EPA Substance Registry System | 2,4-DB (94-82-6) |
Description and Uses
4-(2,4-Dichlorophenoxy)butanoic Acid is a herbicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H411 |
| Precautionary statements | P273-P301+P312+P330 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-51/53 |
| Safety Statements | 25-29-46-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | ES9100000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 |
| Hazardous Substances Data | 94-82-6(Hazardous Substances Data) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |



