A1189612
1-Butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide , 98% , 174899-83-3
Synonym(s):
1-Butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide;1-Butyl-3-methylimidazolium bis(trifluoromethanesulfonyl)amide;1-Butyl-3-methylimidazolium bis(triflyl)imide;BMIIm;BMIM NTF
CAS NO.:174899-83-3
Empirical Formula: C8H15N2.C2F6NO4S2
Molecular Weight: 419.366
MDL number: MFCD05664714
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB220.80 | In Stock |
|
| 100G | RMB780.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 1℃ |
| Density | 1.44 g/cm3 |
| refractive index | n |
| Flash point: | >200 ºC |
| storage temp. | Store below +30°C. |
| Water Solubility | Insoluble in water |
| form | liquid |
| color | Colorless to Light orange to Yellow |
| PH | 7 (H2O, 20℃)Aqueous solution |
| InChI | InChI=1S/C8H15N2.C2F6NO4S2/c1-3-4-5-10-7-6-9(2)8-10;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6-8H,3-5H2,1-2H3;/q+1;-1 |
| InChIKey | INDFXCHYORWHLQ-UHFFFAOYSA-N |
| SMILES | S(=O)(=O)(C(F)(F)F)[N-]S(=O)(=O)C(F)(F)F.[N+]1(C)C=CN(CCCC)C=1 |
| ECW | 4,62 V |
Description and Uses
Ionic liquids (ILs) are molten salts with melting points lower than 100 °C. They usually consist of pair of organic cation and anion. ILs exhibit unique properties such as non-volatility, high thermal stability, and high ionic conductivity and find applications as electrolytes in lithium/sodium ion batteries and dye-sensitized solar cells. They are also used as media for synthesis of conducting polymers and intercalation electrode materials.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311-H314-H373-H411 |
| Precautionary statements | P260-P280-P301+P330+P331+P310-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| target organs | Nervous system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,N |
| Risk Statements | 36/37/38-51/53-48/22-34-24/25 |
| Safety Statements | 26-36-61-45-36/37/39 |
| RIDADR | UN 2922 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8, 6.1 |
| HS Code | 29350090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1B STOT RE 2 Oral |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |










