A1189712
1-Butyl-3-methylimidazolium hydrogen sulfate , 95% , 262297-13-2
Synonym(s):
[BMIM][HSO4]
CAS NO.:262297-13-2
Empirical Formula: C8H16N2O4S
Molecular Weight: 236.29
MDL number: MFCD06798197
EINECS: 200-145-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB31.20 | In Stock |
|
| 25g | RMB100.00 | In Stock |
|
| 100G | RMB375.20 | In Stock |
|
| 500G | RMB1575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 29-32 °C |
| Density | 1.27g/ml |
| Flash point: | 284 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | clear liquid |
| color | Colorless to Red to Green |
| InChI | 1S/C8H15N2.H2O4S/c1-3-4-5-10-7-6-9(2)8-10;1-5(2,3)4/h6-8H,3-5H2,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | KXCVJPJCRAEILX-UHFFFAOYSA-M |
| SMILES | OS([O-])(=O)=O.CCCCn1cc[n+](C)c1 |
Description and Uses
Basionic Ionic Liquids
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 2933.29.9000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |







