A1190612
3-Bromo-2-methylpropene , 95% , 1458-98-6
Synonym(s):
Methallyl bromide;Methylallyl bromide
CAS NO.:1458-98-6
Empirical Formula: C4H7Br
Molecular Weight: 135
MDL number: MFCD00134155
EINECS: 604-496-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB76.80 | In Stock |
|
| 25G | RMB242.40 | In Stock |
|
| 100G | RMB721.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -115.07°C (estimate) |
| Boiling point: | 94-95 °C (lit.) |
| Density | 1.339 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 44 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform, Ethyl Acetate |
| form | Oil |
| color | Clear Colourless to Pale Yellow |
| Specific Gravity | 1.339 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C4H7Br/c1-4(2)3-5/h1,3H2,2H3 |
| InChIKey | USEGQJLHQSTGHW-UHFFFAOYSA-N |
| SMILES | C=C(C)CBr |
| CAS DataBase Reference | 1458-98-6(CAS DataBase Reference) |
Description and Uses
3-Bromo-2-methylpropene may be used:
- in the synthesis of alkenyl imines
- in the synthesis of 2-methylpropenyl (“methallyl”) complex, Cp*Os(η3-allyl)Br2
- in a study of chiral phase transfer alkylation leading to (S)-α-alkylcysteines
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H302+H332-H314-H411 |
| Precautionary statements | P210-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | F,C,N |
| Risk Statements | 11-20/22-34-51/53 |
| Safety Statements | 9-16-26-29-36/37/39-45-61 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 3 |
| HazardClass | 3.1 |
| PackingGroup | II |
| HS Code | 29033990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








