A1193812
2-Bromophenylhydrazine hydrochloride , 98% , 50709-33-6
CAS NO.：50709-33-6
Empirical Formula: C6H8BrClN2
Molecular Weight: 223.5
MDL number: MFCD00012926
EINECS: 256-728-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB107.20 | In Stock |
|
| 100G | RMB380.00 | In Stock |
|
| 500g | RMB1567.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 189 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | slightly sol. in Methanol |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Sensitive | Hygroscopic |
| BRN | 3628612 |
| InChI | InChI=1S/C6H7BrN2.ClH/c7-5-3-1-2-4-6(5)9-8;/h1-4,9H,8H2;1H |
| InChIKey | PHCYUJRYSFMJMG-UHFFFAOYSA-N |
| SMILES | C1(NN)=CC=CC=C1Br.Cl |
| CAS DataBase Reference | 50709-33-6(CAS DataBase Reference) |
Description and Uses
2-Bromophenylhydrazine hydrochloride was used to prepare 6-(3-bromophenylhydrazono)-7,8,9,11-tetrahydropyrido[2,1-b]quinazoline-11-one.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C,Xn |
| Risk Statements | 34-20/21-31-20 |
| Safety Statements | 26-27-36/37/39-45-23 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| PackingGroup | Ⅱ |
| HS Code | 29280000 |
