A1195512
4-Bromothioanisole , 98% , 104-95-0
Synonym(s):
4-Bromophenyl methyl sulfide
CAS NO.：104-95-0
Empirical Formula: C7H7BrS
Molecular Weight: 203.1
MDL number: MFCD00000102
EINECS: 203-255-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB172.80 | In Stock |
|
| 100G | RMB631.20 | In Stock |
|
| 250g | RMB1199.20 | In Stock |
|
| 500g | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-40 °C(lit.) |
| Boiling point: | 128-130 °C10 mm Hg(lit.) |
| Density | 1.5027 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Low Melting Crystalline Mass, Crystals, Crystalline Powder or Chunks |
| Specific Gravity | 1.07 |
| color | White to beige |
| Sensitive | Stench |
| BRN | 1906693 |
| InChI | InChI=1S/C7H7BrS/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3 |
| InChIKey | YEUYZNNBXLMFCW-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(SC)C=C1 |
| CAS DataBase Reference | 104-95-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-4-(methylthio)-(104-95-0) |
Description and Uses
4-Bromothioanisole was used in the synthesis of:
- 4′-nitro-4-mercaptobiphenyl
- 4′-iodo-4-mercaptobiphenyl
- 3′-nitro-4-mercaptobiphenyl
- 3′-iodo-4-mercaptiobiphenyl
- (S)-(–)-p-bromophenyl methyl sulfoxide
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Stench |
| HazardClass | IRRITANT, STENCH |
| HS Code | 29093090 |
