A1196612
2-Bromo-4′-methoxyacetophenone , 98% , 2632-13-5
Synonym(s):
ω-Bromo-4-methoxyacetophenone;4-Methoxyphenacyl bromide
CAS NO.:2632-13-5
Empirical Formula: C9H9BrO2
Molecular Weight: 229.07
MDL number: MFCD00465443
EINECS: 220-118-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB102.40 | In Stock |
|
| 100G | RMB359.20 | In Stock |
|
| 500g | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 69-71 °C(lit.) |
| Boiling point: | 215.8°C (rough estimate) |
| Density | 1.4921 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystals or Crystalline Powder |
| color | Off-white to light brown |
| Water Solubility | It is soluble in DMSO, water (partly miscible), most organic solvents, and methanol. |
| BRN | 743112 |
| InChI | InChI=1S/C9H9BrO2/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-5H,6H2,1H3 |
| InChIKey | XQJAHBHCLXUGEP-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(OC)C=C1)CBr |
| CAS DataBase Reference | 2632-13-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 2-bromo-1-(4-methoxyphenyl)-(2632-13-5) |
Description and Uses
2-Bromo-4'-methoxyacetophenone, is used as a cell-permeable, covalent and potent protein tyrosine phosphatase inhibitor.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37-36/37/38 |
| Safety Statements | 26-27-28-36/37/39-45-37/39 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 8-9-19-21 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29147090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |






