A1197612
2-Bromophenethyl alcohol , 98% , 1074-16-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB77.60 | In Stock |
|
| 25G | RMB351.20 | In Stock |
|
| 100G | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 97 °C/0.7 mmHg (lit.) |
| Density | 1.483 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Ethyl Acetate |
| form | Liquid |
| pka | 14.70±0.10(Predicted) |
| color | Clear slightly yellow |
| Specific Gravity | 1.483 |
| InChI | InChI=1S/C8H9BrO/c9-8-4-2-1-3-7(8)5-6-10/h1-4,10H,5-6H2 |
| InChIKey | ADLOWZRDUHSVRU-UHFFFAOYSA-N |
| SMILES | C1(CCO)=CC=CC=C1Br |
Description and Uses
2-Bromophenethyl alcohol is used as an end capping reagent during the synthesis of rod-coil block copolymers and also as a test compound in the study to evaluate the potential Aedes aegypti repellent chemotype.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29062990 |
| Storage Class | 10 - Combustible liquids |








