A1198212
1-(Diphenylmethyl)-3-hydroxyazetidine , 98% , 18621-17-5
CAS NO.：18621-17-5
Empirical Formula: C16H17NO
Molecular Weight: 239.31
MDL number: MFCD00205109
EINECS: 606-074-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB52.80 | In Stock |
|
| 100G | RMB144.80 | In Stock |
|
| 500g | RMB705.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106 °C |
| Boiling point: | 353.8±42.0 °C(Predicted) |
| Density | 1.189±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 14.24±0.20(Predicted) |
| form | Solid |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C16H17NO/c18-15-11-17(12-15)16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-16,18H,11-12H2 |
| InChIKey | MMAJXKGUZYDTHV-UHFFFAOYSA-N |
| SMILES | N1(C(C2=CC=CC=C2)C2=CC=CC=C2)CC(O)C1 |
| CAS DataBase Reference | 18621-17-5(CAS DataBase Reference) |
Description and Uses
1-(Diphenylmethyl)-3-hydroxyazetidine is used to identify inhibitors of CYP 3A4.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Warning |
| Hazard statements | H315-H319-H314-H318 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN3259 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| HS Code | 29339900 |
