A1198712
α-Bromocinnamaldehyde , 98% , 5443-49-2
CAS NO.:5443-49-2
Empirical Formula: C9H7BrO
Molecular Weight: 211.06
MDL number: MFCD00006965
EINECS: 226-637-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB66.40 | In Stock |
|
| 100G | RMB227.20 | In Stock |
|
| 500G | RMB840.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-68 °C(lit.) |
| Boiling point: | 304.4±30.0 °C(Predicted) |
| Density | 1.4270 (rough estimate) |
| refractive index | 1.5720 (estimate) |
| storage temp. | 2-8°C |
| form | Crystalline Powder |
| color | Light yellow to ochre |
| Cosmetics Ingredients Functions | FRAGRANCE |
| InChI | InChI=1S/C9H7BrO/c10-9(7-11)6-8-4-2-1-3-5-8/h1-7H |
| InChIKey | WQRWNOKNRHCLHV-UHFFFAOYSA-N |
| SMILES | C(=O)C(Br)=CC1=CC=CC=C1 |
| LogP | 2.491 (est) |
| CAS DataBase Reference | 5443-49-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propenal, 2-bromo-3-phenyl-(5443-49-2) |
Description and Uses
α-Bromocinnamaldehyde was used in the synthesis of 3,4-diaryl 1H-pyrazoles. It was also used in the preparation of spiro imidazolidine-oxazolidine intermediate via guanidinium ylide mediated aziridination.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36/37/39-22 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| RTECS | GD6480000 |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






