A1200012
(R)-(+)-2-Bromo-α-methylbenzyl alcohol , 98% , 76116-20-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB128.80 | In Stock |
|
| 1G | RMB332.00 | In Stock |
|
| 5G | RMB1292.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-56 °C (lit.) |
| Boiling point: | 243.5±0.0 °C(Predicted) |
| Density | 1.470±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 14.01±0.20(Predicted) |
| Appearance | White to light yellow Solid |
| optical activity | [α]22/D +54°, c = 1 in chloroform |
| InChI | InChI=1/C8H9BrO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3/t6-/s3 |
| InChIKey | DZLZSFZSPIUINR-ZCFIWIBFSA-N |
| SMILES | C1([C@H](O)C)C=CC=CC=1Br |&1:1,r| |
Description and Uses
It is the most important dyestuff intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







