A1201612
1,4-Butanediol dimethacrylate , Contains 100ppmmehq stabilizer, 95% , 2082-81-7
CAS NO.:2082-81-7
Empirical Formula: C12H18O4
Molecular Weight: 226.27
MDL number: MFCD00008594
EINECS: 218-218-1
| Pack Size | Price | Stock | Quantity |
| 100G | RMB221.60 | In Stock |
|
| 500G | RMB734.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −117 °C(lit.) |
| Boiling point: | 132-134 °C/4 mmHg (lit.) |
| Density | 1.023 g/mL at 25 °C (lit.) |
| vapor density | 2.09 (vs air) |
| vapor pressure | 430 mm Hg ( 25 °C) |
| refractive index | n |
| Flash point: | 38 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Liquid |
| pka | 9.8(at 25℃) |
| color | Clear colorless to slightly yellow |
| Water Solubility | 243mg/L at 20℃ |
| Merck | 14,9710 |
| BRN | 956566 |
| Cosmetics Ingredients Functions | FILM FORMING |
| InChI | 1S/C12H18O4/c1-9(2)11(13)15-7-5-6-8-16-12(14)10(3)4/h1,3,5-8H2,2,4H3 |
| InChIKey | XOJWAAUYNWGQAU-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCCCOC(=O)C(C)=C |
| LogP | 3.1 at 20℃ |
| CAS DataBase Reference | 2082-81-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Butylene glycol dimethacrylate(2082-81-7) |
| EPA Substance Registry System | 1,4-Butanediol dimethacrylate (2082-81-7) |
Description and Uses
Sensitization to 1,4-butanediol dimethacrylate (BUDMA) was reported in dental technieians, with cross reactivity to methylmethacrylate.
cross-linking methacrylic monomer for use in dental-composite materials, sealants, prostheses, etc.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 3-16-26-29-39-36/37/39 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 2 |
| RTECS | PA0350000 |
| F | 9-34 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | I |
| HS Code | 29161400 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Hazardous Substances Data | 2082-81-7(Hazardous Substances Data) |




