A1202712
Bis(triphenylphosphoranylidene)ammonium chloride , 96% , 21050-13-5
Synonym(s):
Bis(triphenylphosphine)iminium chloride;Hexaphenyldiphosphazenium chloride;PPNCl
CAS NO.:21050-13-5
Empirical Formula: C36H30ClNP2
Molecular Weight: 574.04
MDL number: MFCD00151523
EINECS: 244-170-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB88.00 | In Stock |
|
| 25G | RMB338.40 | In Stock |
|
| 100G | RMB1192.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270-272 °C(lit.) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Powder |
| color | white |
| Water Solubility | Moderately soluble in water. |
| BRN | 4097979 |
| InChI | InChI=1S/C36H30ClNP2/c37-40(34-25-13-4-14-26-34,35-27-15-5-16-28-35,36-29-17-6-18-30-36)38-39(31-19-7-1-8-20-31,32-21-9-2-10-22-32)33-23-11-3-12-24-33/h1-30H |
| InChIKey | QMTYWEYUVVWPQL-UHFFFAOYSA-N |
| SMILES | P(Cl)(C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)N=P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1 |
| CAS DataBase Reference | 21050-13-5(CAS DataBase Reference) |
Description and Uses
Co-catalyst used with a chiral Cobalt-salen complex for the asymmetric addition of carbon dioxide to propylene oxide. Also used in the preparation of 5-Hydroxy-clethodim Sulfoxide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H332-H335 |
| Precautionary statements | P261-P264-P271-P302+P352-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20 |
| Safety Statements | 26-36-38-36/37/39-22 |
| WGK Germany | 3 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




