A1205212
4-Bromo-2-chloropyridine , 97% , 73583-37-6
CAS NO.:73583-37-6
Empirical Formula: C5H3BrClN
Molecular Weight: 192.44
MDL number: MFCD03840756
EINECS: 629-180-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB55.20 | In Stock |
|
| 25G | RMB199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27 C |
| Boiling point: | 70 °C / 3mmHg |
| Density | 1.7336 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 225 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Powder |
| pka | 0.24±0.10(Predicted) |
| color | Yellow |
| Specific Gravity | 1.7336 |
| Water Solubility | Not miscible or difficult to mix in water. |
| InChI | InChI=1S/C5H3BrClN/c6-4-1-2-8-5(7)3-4/h1-3H |
| InChIKey | ONHMWUXYIFULDO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(Br)=C1 |
| CAS DataBase Reference | 73583-37-6(CAS DataBase Reference) |
Description and Uses
It is used in the synthesis of quaterpyridine nemertelline.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-37/38-41-36/37/38 |
| Safety Statements | 26-36-36/37/39-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |








