A1205512
3-Bromo-2-hydroxypyridine , 97% , 13466-43-8
Synonym(s):
3-Bromo-2(1H)-pyridinone
CAS NO.:13466-43-8
Empirical Formula: C5H4BrNO
Molecular Weight: 174
MDL number: MFCD03411569
EINECS: 626-942-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.00 | In Stock |
|
| 5G | RMB91.20 | In Stock |
|
| 25G | RMB376.00 | In Stock |
|
| 100G | RMB1347.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 179-183 °C |
| Boiling point: | 336.6±42.0 °C(Predicted) |
| Density | 1.776±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 10.53±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to off-white |
| Water Solubility | Slightly soluble in water. |
| BRN | 109846 |
| InChI | InChI=1S/C5H4BrNO/c6-4-2-1-3-7-5(4)8/h1-3H,(H,7,8) |
| InChIKey | YDUGVOUXNSWQSW-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC=C1Br |
| CAS DataBase Reference | 13466-43-8(CAS DataBase Reference) |
Description and Uses
3-Bromo-2-hydroxypyridine is sued as an active ingredient pharmaceuticals, in medicine.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36-39 |
| WGK Germany | 3 |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







