A1206112
1,3,5-Benzenetricarbonyl trichloride , 98% , 4422-95-1
Synonym(s):
Benzene-1,3,5-tricarbonyl chloride;Trimesic acid trichloride;Trimesoyl chloride
CAS NO.:4422-95-1
Empirical Formula: C9H3Cl3O3
Molecular Weight: 265.48
MDL number: MFCD00000679
EINECS: 224-594-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB140.80 | In Stock |
|
| 100G | RMB405.60 | In Stock |
|
| 250g | RMB911.20 | In Stock |
|
| 500G | RMB1599.20 | In Stock |
|
| 1kg | RMB2959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 32-38 °C (lit.) |
| Boiling point: | 180 °C/16 mmHg (lit.) |
| Density | 1.487 g/mL at 25 °C (lit.) |
| refractive index | 1.5945-1.5965 |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | decomposes |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 2940936 |
| InChI | 1S/C9H3Cl3O3/c10-7(13)4-1-5(8(11)14)3-6(2-4)9(12)15/h1-3H |
| InChIKey | UWCPYKQBIPYOLX-UHFFFAOYSA-N |
| SMILES | ClC(=O)c1cc(cc(c1)C(Cl)=O)C(Cl)=O |
| CAS DataBase Reference | 4422-95-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3,5-Benzenetricarbonyl trichloride(4422-95-1) |
| EPA Substance Registry System | 1,3,5-Benzenetricarbonyl trichloride (4422-95-1) |
Description and Uses
1,3,5-Benzenetricarbonyl trichloride was used in the synthesis of chiral azoaromatic dendrimeric systems. It was used to study the structure of activated composite membranes containing organophosphorus extractants as carriers. It was the starting material for two tritopic amides derived from 3- and 4-methylaminopyridine which self-assembled into nanoballs on treatment with palladium(II) nitrate in DMSO.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 14-22-34 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29173980 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |




