A1208612
Boc-Cys(trt)-OH , 99% , 21947-98-8
CAS NO.:21947-98-8
Empirical Formula: C27H29NO4S
Molecular Weight: 463.59
MDL number: MFCD00038251
EINECS: 244-674-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB55.20 | In Stock |
|
| 25G | RMB144.00 | In Stock |
|
| 100g | RMB414.40 | In Stock |
|
| 500g | RMB1734.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 143-146 °C(lit.) |
| alpha | 27.5 º (c=1, EtOH) |
| Boiling point: | 610.9±55.0 °C(Predicted) |
| Density | 1.200±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.82±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D +27.5°, c = 1 in ethanol |
| BRN | 2028965 |
| Major Application | peptide synthesis |
| InChIKey | JDTOWOURWBDELG-QHCPKHFHSA-N |
| SMILES | C(O)(=O)[C@H](CSC(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 21947-98-8(CAS DataBase Reference) |
Description and Uses
Boc-Cys(Trt)-OH is used in method for preparing ularitide.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 2930 90 16 |
| Storage Class | 11 - Combustible Solids |






