A1210412
Benzo-1,4-dioxane , 98% , 493-09-4
Synonym(s):
1,2-Ethylenedioxybenzene;1,4-Benzodioxan;2,3-Dihydro-1,4-benzodioxin
CAS NO.:493-09-4
Empirical Formula: C8H8O2
Molecular Weight: 136.15
MDL number: MFCD00006821
EINECS: 207-775-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 10G | RMB45.60 | In Stock |
|
| 25g | RMB85.60 | In Stock |
|
| 50G | RMB164.00 | In Stock |
|
| 250G | RMB719.20 | In Stock |
|
| 500g | RMB1239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-217 °C |
| Boiling point: | 103 °C6 mm Hg(lit.) |
| Density | 1.142 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 190 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.142 |
| color | Clear colorless to light yellow |
| Water Solubility | insoluble |
| BRN | 120846 |
| InChI | InChI=1S/C8H8O2/c1-2-4-8-7(3-1)9-5-6-10-8/h1-4H,5-6H2 |
| InChIKey | BNBQRQQYDMDJAH-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2OCC1 |
| CAS DataBase Reference | 493-09-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Dioxatetralin(493-09-4) |
| EPA Substance Registry System | 1,4-Benzodioxin, 2,3-dihydro- (493-09-4) |
Description and Uses
Benzo-1,4-dioxane (2,3-dihydro-1,4-benzodioxin) is used in the synthesis of stereoisomers which were evaluated as α- and β- adrenergic antagonists
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210-P280-P403+P235-P501-P210e-P280a-P370+P378a-P501a |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| RTECS | DF4728000 |
| Hazard Note | Irritant |
| HS Code | 29329995 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 3 |
| Excepted Quantities | Non-Hazardous |






