A1210612
2-Bromo-3-methylthiophene , 99% , 14282-76-9
CAS NO.:14282-76-9
Empirical Formula: C5H5BrS
Molecular Weight: 177.06
MDL number: MFCD00059741
EINECS: 238-175-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB33.60 | In Stock |
|
| 25G | RMB83.20 | In Stock |
|
| 100G | RMB264.00 | In Stock |
|
| 500G | RMB1102.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25 °C |
| Boiling point: | 173-176 °C (lit.) |
| Density | 1.572 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 155 °F |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, Ethyl Acetate |
| Water Solubility | Insoluble in water |
| form | liquid |
| Specific Gravity | 1.580 |
| color | Pale yellow |
| BRN | 105719 |
| InChI | InChI=1S/C5H5BrS/c1-4-2-3-7-5(4)6/h2-3H,1H3 |
| InChIKey | YYJBWYBULYUKMR-UHFFFAOYSA-N |
| SMILES | C1(Br)SC=CC=1C |
| CAS DataBase Reference | 14282-76-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Thiophene, 2-bromo-3-methyl-(14282-76-9) |
Description and Uses
2-Bromo-3-methylthiophene was used in the preparation of poly(3,3′′′-dimethyl-(2,2′:5′,2′:5′,2′′′)tetrathiophene)). It was also used in the preparation of 2-bromo-3-(bromomethyl)thiophene, lachrymatory compound.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | T,Xi,Xn |
| Risk Statements | 25-41-43-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2810 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | IRRITANT-HARMFUL, KEEP COLD |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29349990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






