A1210750
Phenprobamate , ≥97% , 673-31-4
CAS NO.：673-31-4
Empirical Formula: C10H13NO2
Molecular Weight: 179.22
MDL number: MFCD00868163
EINECS: 211-606-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB32.80 | In Stock |
|
| 5g | RMB119.20 | In Stock |
|
| 25g | RMB399.20 | In Stock |
|
| 100g | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 101-104° |
| Boiling point: | 311.75°C (rough estimate) |
| Density | 1.1248 (rough estimate) |
| refractive index | 1.5710 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.47±0.50(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C10H13NO2/c11-10(12)13-8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H2,11,12) |
| InChIKey | CAMYKONBWHRPDD-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)CCCOC(=O)N |
| CAS DataBase Reference | 673-31-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Carbamic acid, 3-phenylpropyl ester(673-31-4) |
Description and Uses
Phenprobamate (3-phenylpropylcarbamate) is a centrally acting muscle relaxant with mild sedative and anticonvulsant effects. Muscle relaxants can enhance and prolong the effect of narcotic drugs and enable to obtain same effect with a smaller amount of alcohol or illicit substance.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Toxicity | LD50 orally in mice: 840 mg/kg (Stille) |
