A1212212
4-Bromophenylboronic acid , 97% , 5467-74-3
Synonym(s):
(p-Bromophenyl)boronic acid;p-Bromobenzeneboronic acid;p-Bromophenylboric acid;4-Bromobenzeneboronic acid;4-Bromophenylboric acid
CAS NO.:5467-74-3
Empirical Formula: C6H6BBrO2
Molecular Weight: 200.83
MDL number: MFCD00002104
EINECS: 226-779-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB160.00 | In Stock |
|
| 100g | RMB481.60 | In Stock |
|
| 500g | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 284-288 °C (lit.) |
| Boiling point: | 315.0±44.0 °C(Predicted) |
| Density | 1.67±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 8.32±0.10(Predicted) |
| form | Crystalline Powder |
| color | Off-white to light beige |
| Water Solubility | Soluble in methanol. Insoluble in water. |
| BRN | 2936347 |
| InChI | InChI=1S/C6H6BBrO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4,9-10H |
| InChIKey | QBLFZIBJXUQVRF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(Br)C=C1)(O)O |
| CAS DataBase Reference | 5467-74-3(CAS DataBase Reference) |
Description and Uses
Labelled 4-Bromophenylboronic Acid (B686545). 4-Bromophenylboric acid is used in the preparation of arylboronates as inhibitors of fatty acid amide hydrolase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | CY8650000 |
| TSCA | T |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





