A1213612
Benzyltrimethylammonium chloride , 98% , 56-93-9
Synonym(s):
Benzyltrimethylammonium chloride;Trimethylbenzylammonium chloride
CAS NO.:56-93-9
Empirical Formula: C10H16ClN
Molecular Weight: 185.69
MDL number: MFCD00011782
EINECS: 200-300-3
| Pack Size | Price | Stock | Quantity |
| 25G | RMB31.20 | In Stock |
|
| 100G | RMB39.20 | In Stock |
|
| 250g | RMB71.20 | In Stock |
|
| 500G | RMB125.60 | In Stock |
|
| 2.5KG | RMB423.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239 °C (dec.) (lit.) |
| Boiling point: | 305.52°C (rough estimate) |
| Density | 1.08 g/mL at 25 °C |
| vapor pressure | <0.0001 hPa (20 °C) |
| refractive index | n |
| Flash point: | ?50° (for 61%sol), d: 1.07 at 20°/20° (61% sol) |
| storage temp. | Store below +30°C. |
| solubility | 800g/l |
| form | Crystalline Powder or Chunks |
| color | White to ivory |
| PH | 6-8 (100g/l, H2O, 20℃) |
| Odor | Faint, almond like odor |
| PH Range | 6 - 8 |
| Water Solubility | 800 g/L |
| Sensitive | Hygroscopic |
| BRN | 3917255 |
| Stability: | Stable. Hygroscopic. Incompatible with strong oxidizing agents. |
| InChI | 1S/C10H16N.ClH/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KXHPPCXNWTUNSB-UHFFFAOYSA-M |
| SMILES | [Cl-].C[N+](C)(C)Cc1ccccc1 |
| CAS DataBase Reference | 56-93-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzyltrimethylammonium chloride (56-93-9) |
Description and Uses
Solvent for cellulose, gelling inhibitor in polyester resins, intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H311-H332-H341-H412 |
| Precautionary statements | P201-P273-P280-P301+P310-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/38-36 |
| Safety Statements | 26-37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | BO8400000 |
| F | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Acute Tox. 4 Inhalation Aquatic Chronic 3 Muta. 2 |
| Hazardous Substances Data | 56-93-9(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 500 mg/kg |





