A1226212
Blue Tetrazolium , ≥95%(T) , 1871-22-3
Synonym(s):
3,3′-(3,3′-Dimethoxy[1,1′-biphenyl]-4,4′-diyl)-bis(2,5-diphenyl-2H-tetrazolium) dichloride;3,3′-Dianisole-4,4′-bis(3,5-diphenyltetrazolium chloride);Blue Tetrazolium chloride;BTC;TZ
CAS NO.:1871-22-3
Empirical Formula: C40H32Cl2N8O2
Molecular Weight: 727.64
MDL number: MFCD00040933
EINECS: 217-488-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB157.60 | In Stock |
|
| 5G | RMB684.80 | In Stock |
|
| 25G | RMB3519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 255 °C (dec.)(lit.) |
| Density | 1.9137 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | room temp |
| solubility | Soluble in water;freely soluble ethanol, methanol, chloroform; insoluble in acetone, ether, ethyl acetate |
| form | crystals or powder |
| color | Lemon yellow |
| Odor | Odorless |
| biological source | bovine nose |
| Water Solubility | Soluble in hot water (5 mg/ml), methanol (50 mg/ml), ethanol, and chloroform. Insoluble in acetone. |
| λmax | 253 nm |
| Merck | 14,9244 |
| BRN | 3894077 |
| Stability: | Stable, but may be light sensitive. Incompatible with strong oxidizing agents. |
| Major Application | microbiology |
| Biological Applications | Cellular response evaluation assays; microbial growth assays; tannins assays; anti-cancer agents; diagnostic test strips; detecting lactate dehydrogenase (LDH) isoenzymes,gamma-hydroxybutyric acid (GHB); measuring ATP,numb |
| InChIKey | MUUHXGOJWVMBDY-UHFFFAOYSA-L |
| SMILES | [Cl-].[Cl-].COc1cc(ccc1-[n+]2nc(nn2-c3ccccc3)-c4ccccc4)-c5ccc(c(OC)c5)-[n+]6nc(nn6-c7ccccc7)-c8ccccc8 |
| CAS DataBase Reference | 1871-22-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-Tetrazolium, 2,2'-(3,3'-dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis[3,5-diphenyl-, dichloride (1871-22-3) |
Description and Uses
For research in seed germination, as stain for bacteria and molds, in histochemical studies, to demonstrate oxidation-reduction enzymes in normal and cancerous tissues. See also Triphenyltetrazolium Chloride.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H350 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 45-36/37/38 |
| Safety Statements | 53-45-36-26-24/25 |
| WGK Germany | 3 |
| RTECS | XF8050000 |
| F | 3-8-10 |
| TSCA | TSCA listed |
| HS Code | 29339990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B |




