A1231312
N-Benzoyl-L-tyrosine ethyl ester , 98% , 3483-82-7
Synonym(s):
BTEE
CAS NO.:3483-82-7
Empirical Formula: C18H19NO4
Molecular Weight: 313.35
MDL number: MFCD00002388
EINECS: 222-469-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB97.60 | In Stock |
|
| 25G | RMB400.00 | In Stock |
|
| 100G | RMB1333.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-121 °C(lit.) |
| alpha | -24 º (c=1, EtOH) |
| Boiling point: | 453.15°C (rough estimate) |
| Density | 1.2389 (rough estimate) |
| refractive index | -29 ° (C=1, EtOH) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | almost transparency in Methanol |
| pka | 9.75±0.15(Predicted) |
| form | Powder |
| color | White to slightly yellow |
| optical activity | [α]20/D 26±3°, c = 1% in ethanol |
| BRN | 2223819 |
| InChI | 1S/C18H19NO4/c1-2-23-18(22)16(12-13-8-10-15(20)11-9-13)19-17(21)14-6-4-3-5-7-14/h3-11,16,20H,2,12H2,1H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | SRLROPAFMUDDRC-INIZCTEOSA-N |
| SMILES | CCOC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)c2ccccc2 |
| CAS DataBase Reference | 3483-82-7(CAS DataBase Reference) |
| EPA Substance Registry System | L-Tyrosine, N-benzoyl-, ethyl ester (3483-82-7) |
Description and Uses
N-Benzoyl-L-tyrosine ethyl ester is a synthetic substrate used to study IMER systems.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Warning |
| Hazard statements | H314 |
| Precautionary statements | P264b-P271-P280-P301+P330+P331-P304+P340-P305+P351+P338-P310-P363-P403+P233-P501c |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |




