A1232212
Bromocresol green sodium salt , Indicator , 62625-32-5
Synonym(s):
3′,3′′,5′,5′′-Tetrabromo-m-cresolsulfonephthalein sodium salt
CAS NO.:62625-32-5
Empirical Formula: C21H13Br4NaO5S
Molecular Weight: 720
MDL number: MFCD00148898
EINECS: 263-657-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB45.60 | In Stock |
|
| 25G | RMB159.20 | In Stock |
|
| 100g | RMB668.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 230 °C (dec.)(lit.) |
| Density | 0.981 g/mL at 25 °C |
| storage temp. | Store at +15°C to +25°C. |
| solubility | H2O: soluble1mg/mL |
| form | Solid |
| pka | 4.7(at 25℃) |
| color | Green |
| PH Range | 4(Yellow)-5.6(Blue) |
| Odor | Characteristic odour |
| Water Solubility | Soluble in water and ethanol. |
| ε(extinction coefficient) | ≥10000 at 306-312nm ≥8000 at 397-403nm |
| λmax | 617nm, 400nm |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | Colloidal pigments |
| InChI | 1S/C21H14Br4O5S.Na/c1-9-12(7-14(22)19(26)17(9)24)21(13-8-15(23)20(27)18(25)10(13)2)11-5-3-4-6-16(11)31(28,29)30-21;/h3-8,26-27H,1-2H3;/q;+1/p-1 |
| InChIKey | HEFSGAHJDGZCHA-UHFFFAOYSA-M |
| SMILES | [Na+].Cc1c(Br)c(O)c(Br)cc1\C(=C2\C=C(Br)C(=O)C(Br)=C2C)c3ccccc3S([O-])(=O)=O |
| CAS DataBase Reference | 62625-32-5(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 4,4'-(2,2-dioxido-3H-1,2-benzoxathiol-3-ylidene)bis[2,6-dibromo-3-methyl-, monosodium salt (62625-32-5) |
Description and Uses
Bromocresol Green sodium salt is used as a pH indicator. It is a pH sensitive triphenylmethane dye useful in various colorimetric detection studies and as an activity tracking dye for DNA agarose gel electrophoresis. It is also used in TLC (thin-layer chromatography) for visualizing compounds containing functional groups having pKa less than 5.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2934 99 90 |
| Storage Class | 11 - Combustible Solids |



