A1237312
TBDMS triflate , 98% , 69739-34-0
Synonym(s):
TBDMS triflate;tert-Butyldimethylsilyl trifluoromethanesulfonate;Trifluoromethanesulfonic acid tert-butyldimethylsilyl ester, tert-Butyldimethylsilyl triflate;Trifluoromethanesulfonic acid tert-butyldimethylsilylester
CAS NO.:69739-34-0
Empirical Formula: C7H15F3O3SSi
Molecular Weight: 264.34
MDL number: MFCD00000405
EINECS: 274-102-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB40.00 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100G | RMB333.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 65-67 °C12 mm Hg(lit.) |
| Density | 1.151 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 98 °F |
| storage temp. | 2-8°C |
| solubility | Slightly miscible with chloroform. |
| form | Fuming Liquid |
| Specific Gravity | 1.151 |
| color | Clear colorless to yellow |
| Water Solubility | DECOMPOSES |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 2370068 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C7H15F3O3SSi/c1-6(2,3)15(4,5)13-14(11,12)7(8,9)10/h1-5H3 |
| InChIKey | WLLIXJBWWFGEHT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OS(=O)(=O)C(F)(F)F |
| CAS DataBase Reference | 69739-34-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Tert-butyldimethylsilyl trifluoromethanesulfonate(69739-34-0) |
Description and Uses
tert-Butyldimethylsilyl trifluoromethanesulfonate is involved in the introduction of a bulky tert-butyl dimethylsilyl group onto a cis-bis(alkenyl)oxirane used in Cope rearrangement. It is associated with a thiolane and promotes the chalcogenide-Morita-Baylis-Hillman reaction. Further, it is used as a highly reactive silylating agent. In addition to this, it is used to prepare enol silyl ethers by reacting with ketones and lactones.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H226-H314-H335 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,F |
| Risk Statements | 10-34-37 |
| Safety Statements | 26-36/37/39-45-25-16 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Flammable/Corrosive |
| TSCA | No |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29310095 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







