A1238312
5-Bromo-m-xylene , 98% , 556-96-7
Synonym(s):
5-Bromo-m-xylene
CAS NO.：556-96-7
Empirical Formula: C8H9Br
Molecular Weight: 185.06
MDL number: MFCD00000087
EINECS: 629-686-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB47.20 | In Stock |
|
| 100G | RMB126.40 | In Stock |
|
| 500G | RMB580.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -20.49°C (estimate) |
| Boiling point: | 202-204 °C(lit.) |
| Density | 1.362 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 189 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Miscible with tetrahydrofuran. |
| form | Liquid |
| color | Clear colorless to light yellow |
| Specific Gravity | 1.362 |
| BRN | 1926375 |
| InChI | InChI=1S/C8H9Br/c1-6-3-7(2)5-8(9)4-6/h3-5H,1-2H3 |
| InChIKey | LMFRTSBQRLSJHC-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(C)=CC(C)=C1 |
| CAS DataBase Reference | 556-96-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-bromo-3,5-dimethyl-(556-96-7) |
Description and Uses
1-Bromo-3,5-dimethylbenzene has been used in the synthesis of substituted 2,2′-bis(diphenylphosphanylmethyl)-1,1′-binaphthyl derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29036990 |
