A1238712
2-Bromophenylboronic acid , 97% , 244205-40-1
Synonym(s):
o-Bromophenylboronic acid
CAS NO.:244205-40-1
Empirical Formula: C6H6BBrO2
Molecular Weight: 200.83
MDL number: MFCD01114672
EINECS: 678-199-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB47.20 | In Stock |
|
| 25G | RMB212.80 | In Stock |
|
| 100G | RMB780.80 | In Stock |
|
| 500g | RMB2911.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113 °C(lit.) |
| Boiling point: | 329.2±44.0 °C(Predicted) |
| Density | 1.67±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly), Methanol (Sparingly) |
| form | Powder |
| pka | 8.25±0.58(Predicted) |
| color | White to off-white |
| Water Solubility | Soluble in methanol. Slightly soluble in water. |
| BRN | 8542615 |
| InChI | InChI=1S/C6H6BBrO2/c8-6-4-2-1-3-5(6)7(9)10/h1-4,9-10H |
| InChIKey | PLVCYMZAEQRYHJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1Br)(O)O |
| CAS DataBase Reference | 244205-40-1(CAS DataBase Reference) |
Description and Uses
2-Bromobenzeneboronic acid is a boronic acid derivative that is widely used in organic synthesis for carbon-carbon bond formation. In Suzuki coupling, aryl halides and boronic acid aryl or vinyl esters or boronic acids are coupled using Pd(PPh3)4.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





