A1239750
bariumdimetaphosphate , ≥99% , 13762-83-9
Synonym(s):
Barium dimetaphosphate;Barium polyphosphate
CAS NO.：13762-83-9
Empirical Formula: BaO6P2
Molecular Weight: 295.27
MDL number: MFCD00061417
EINECS: 237-362-6
| Pack Size | Price | Stock | Quantity |
| 100g | RMB141.60 | In Stock |
|
| 500g | RMB480.00 | In Stock |
|
| 2.5kg | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 1560 °C (lit.) |
| solubility | H2O: insoluble(lit.) |
| form | Powder |
| Water Solubility | Insoluble in water. Soluble in acids by a slow dissolution |
| InChI | 1S/Ba.2HO3P/c;2*1-4(2)3/h;2*(H,1,2,3)/q+2;;/p-2 |
| InChIKey | XNJIKBGDNBEQME-UHFFFAOYSA-L |
| SMILES | [Ba++].[O-]P(=O)=O.[O-]P(=O)=O |
| CAS DataBase Reference | 13762-83-9 |
Description and Uses
Glasses, porcelains, and enamels.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H332 |
| Precautionary statements | P261-P264-P270-P301+P312a-P304+P340-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/22 |
| Safety Statements | 28 |
| RIDADR | UN 1564 6.1/PG 3 |
| WGK Germany | 1 |
| F | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
