A1240812
(R)-(-)-BNP acid , 98% , 39648-67-4
Synonym(s):
(R)-(−)-1,1′-Binaphthalene-2,2′-diyl hydrogen phosphate;(R)-4-Hydroxydinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin-4-oxide
CAS NO.:39648-67-4
Empirical Formula: C20H13O4P
Molecular Weight: 348.29
MDL number: MFCD00010045
EINECS: 609-734-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB67.20 | In Stock |
|
| 25G | RMB221.60 | In Stock |
|
| 100G | RMB735.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C |
| alpha | -607.5 º (c=1.4,MeOH) |
| Boiling point: | 619.5±38.0 °C(Predicted) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| refractive index | -595 ° (C=1, MeOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Solubility in hot Methanol, almost transparency. |
| pka | 1.14±0.20(Predicted) |
| form | Powder |
| color | white |
| optical activity | [α]20/D 605°, c = 1.35 in methanol |
| BRN | 4713363 |
| InChI | InChI=1S/C20H13O4P/c21-25(22)23-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)24-25/h1-12H,(H,21,22) |
| InChIKey | JEHUZVBIUCAMRZ-UHFFFAOYSA-N |
| SMILES | O=P1(OC2C=CC3C=CC=CC=3C=2C2=C3C=CC=CC3=CC=C2O1)O |
| CAS DataBase Reference | 39648-67-4(CAS DataBase Reference) |
Description and Uses
The R enantiomer of binaphthol derivative as chiral quenching agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P332+P313-P362+P364 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22 |
| RIDADR | 3464 |
| WGK Germany | 3 |
| RTECS | RZ2475100 |
| F | 10-23 |
| HS Code | 29199000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Irrit. 2 |




![(11bR)-2,6-Bis(4-(tert-butyl)phenyl)-4-hydroxydinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine4-oxide](https://img.chemicalbook.com/CAS/20180808/GIF/861909-30-0.gif)
![(11bS)-4-Hydroxy-2,6-bis(4-nitrophenyl)dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine4-oxide](https://img.chemicalbook.com/CAS/GIF/878111-16-1.gif)

