A1241950
2,2-Difluoro-2-(trimethylsilyl)aceticAcidEthylEster , ≥97%(GC) , 205865-67-4
CAS NO.：205865-67-4
Empirical Formula: C7H14F2O2Si
Molecular Weight: 196.27
MDL number: MFCD04973092
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB212.00 | In Stock |
|
| 1g | RMB530.40 | In Stock |
|
| 5g | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 55°C/20mmHg(lit.) |
| Density | 1.010±0.06 g/cm3(Predicted) |
| refractive index | 1.3930 to 1.3970 |
| storage temp. | Storage temp. 2-8°C |
| form | clear liquid to cloudy liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C7H14F2O2Si/c1-5-11-6(10)7(8,9)12(2,3)4/h5H2,1-4H3 |
| InChIKey | DYAKYYSMROBYNG-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(F)(F)[Si](C)(C)C |
Description and Uses
Ethyl 2,2-difluoro-2-(trimethylsilyl)acetate is a reagent for organic difluoromethylation and difluoromethylenation reactions.
Safety
| Symbol(GHS) |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P280-P370+P378-P303+P361+P353-P403+P235 |
| RIDADR | UN 3272 3/PG III |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2915390090 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
