A1242912
2,5-Di-tert-butylhydroquinone (DBHQ) , 98% , 88-58-4
Synonym(s):
2,5-Di-( t-butyl)-1,4-hydroquinone, t-BuBHQ;2,5-Di-(t-butyl)-1,4-hydroquinone, t-BuBHQ;2,5-Di-tert-butylhydroquinone;BHQ - CAS 88-58-4 - Calbiochem
CAS NO.:88-58-4
Empirical Formula: C14H22O2
Molecular Weight: 222.32
MDL number: MFCD00008825
EINECS: 201-841-8
| Pack Size | Price | Stock | Quantity |
| 25G | RMB26.40 | In Stock |
|
| 100G | RMB63.20 | In Stock |
|
| 500G | RMB176.00 | In Stock |
|
| 250g | RMB191.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 216-218 °C(lit.) |
| Boiling point: | 321°C |
| Density | 1,07 g/cm3 |
| refractive index | 1.4576 (estimate) |
| Flash point: | 216 °C |
| storage temp. | Store below +30°C. |
| solubility | almost transparency in Methanol |
| pka | 11.89±0.23(Predicted) |
| form | Crystalline Powder |
| color | Light beige to pink-beige |
| Water Solubility | 3.8mg/L at 20℃ |
| BRN | 2049542 |
| Stability: | Stable. Incompatible with oxidizing agents. |
| Cosmetics Ingredients Functions | ANTIOXIDANT |
| Cosmetic Ingredient Review (CIR) | 2,5-Di-tert-butylhydroquinone (88-58-4) |
| InChI | 1S/C14H22O2/c1-13(2,3)9-7-12(16)10(8-11(9)15)14(4,5)6/h7-8,15-16H,1-6H3 |
| InChIKey | JZODKRWQWUWGCD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(O)c(cc1O)C(C)(C)C |
| LogP | 274 at 30℃ |
| CAS DataBase Reference | 88-58-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Benzenediol, 2,5-bis(1,1-dimethylethyl)-(88-58-4) |
| EPA Substance Registry System | 1,4-Benzenediol, 2,5-bis(1,1-dimethylethyl)- (88-58-4) |
Description and Uses
2,5-Di-tert-butylhydroquinone, also known as 2,5-TBHQ or DTBHQ, belongs to the class of organic compounds known as phenylpropanes. These are organic compounds containing a phenylpropane moiety. It is a phenol derivative containing 2 phenol groups and 2 alkyl groups, each consisting of three methyl groups.
2,5-Di-tert-butylhydroquinone is the oxidation substrate used to measure the catalytic activity of the copper(II) enzyme-like catalysts.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H317-H335-H410 |
| Precautionary statements | P261-P264-P273-P280-P301+P310-P302+P352 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-24/25 |
| WGK Germany | 3 |
| RTECS | MX5160000 |
| Autoignition Temperature | 790 °F |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29072900 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 STOT SE 3 |





