A1246712
3-Bromobenzenesulfonyl Chloride , 98% , 2905-24-0
CAS NO.:2905-24-0
Empirical Formula: C6H4BrClO2S
Molecular Weight: 255.52
MDL number: MFCD00052313
EINECS: 628-300-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB52.00 | In Stock |
|
| 25G | RMB196.00 | In Stock |
|
| 100G | RMB433.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30-33 °C |
| Boiling point: | 90-91 °C/0.5 mmHg (lit.) |
| Density | 1.773 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >110 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Clear colorless to yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2691656 |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C6H4BrClO2S/c7-5-2-1-3-6(4-5)11(8,9)10/h1-4H |
| InChIKey | PJGOLCXVWIYXRQ-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=CC=CC(Br)=C1 |
| CAS DataBase Reference | 2905-24-0(CAS DataBase Reference) |
Description and Uses
3-Bromobenzenesulfonyl chloride may be used in the preparation of:
- 2-(3-bromophenyl)-5-n-butylfuran
- 2-(3-bromophenyl)-3,6-dimethyl-4,5,6,7-tetrahydrobenzofuran
- 3-bromo-4-(3-bromophenyl)thiophene
- 2,5-bis(3-bromophenyl)-1-methylpyrrole
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C,Xn |
| Risk Statements | 34-36/37/38-20/21/22 |
| Safety Statements | 26-36/37/39-45-36 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |



