A1247012
4-Benzyloxybenzaldehyde , 98% , 4397-53-9
CAS NO.:4397-53-9
Empirical Formula: C14H12O2
Molecular Weight: 212.24
MDL number: MFCD00003387
EINECS: 224-527-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB55.20 | In Stock |
|
| 100G | RMB199.20 | In Stock |
|
| 500G | RMB932.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 71-74 °C (lit.) |
| Boiling point: | 197-199 °C (11 mmHg) |
| Density | 1.1035 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point: | 197-199°C/20mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Sparingly) |
| form | Crystalline Powder |
| color | Creamish to yellow |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| BRN | 1242385 |
| InChI | 1S/C14H12O2/c15-10-12-6-8-14(9-7-12)16-11-13-4-2-1-3-5-13/h1-10H,11H2 |
| InChIKey | ZVTWZSXLLMNMQC-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1ccc(OCc2ccccc2)cc1 |
| LogP | 3.360 (est) |
| CAS DataBase Reference | 4397-53-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzyl 4-formylphenyl ether(4397-53-9) |
| EPA Substance Registry System | Benzaldehyde, 4-(phenylmethoxy)- (4397-53-9) |
Description and Uses
4-Benzyloxybenzaldehyde is used in the synthesis of (5-fluoro-(2R*,3S*)-2,3-bis(4-hydroxyphenyl)pentanenitrile),an estrogen receptor β-selective ligand. It is a position isomer of the adenylyl cyclase activator 2-benzyloxybenzaldehyde.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P271-P280 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 9-23 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29124900 |
| Storage Class | 11 - Combustible Solids |







