A1253712
S-Benzyl-L-cysteine , 98% , 3054-01-1
CAS NO.:3054-01-1
Empirical Formula: C10H13NO2S
Molecular Weight: 211.28
MDL number: MFCD00002613
EINECS: 221-273-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB45.60 | In Stock |
|
| 25G | RMB145.60 | In Stock |
|
| 100G | RMB399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 214 °C (dec.) (lit.) |
| alpha | 26 º (c=0.4, 1N NaOH) |
| Boiling point: | 379.2±42.0 °C(Predicted) |
| Density | 1.2079 (rough estimate) |
| refractive index | 29 ° (C=1, 1mol/L NaOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in 1mol/L NaOH |
| form | powder to crystaline |
| pka | 2.10±0.10(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D +23°, c = 2 in 1 M NaOH |
| BRN | 1879358 |
| Major Application | detection peptide synthesis |
| InChI | 1S/C10H13NO2S/c11-9(10(12)13)7-14-6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H,12,13)/t9-/m0/s1 |
| InChIKey | GHBAYRBVXCRIHT-VIFPVBQESA-N |
| SMILES | N[C@@H](CSCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 3054-01-1(CAS DataBase Reference) |
| EPA Substance Registry System | L-Cysteine, S-(phenylmethyl)- (3054-01-1) |
Description and Uses
detection
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-28-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29309090 |
| Storage Class | 11 - Combustible Solids |





