A1254312
Boc-Asp-OBzl , 98% , 30925-18-9
Synonym(s):
Boc-L -aspartic acid 1-benzyl ester;Boc-Asp-OBzl;N-α-t.-Boc-L-aspartic acid α-benzyl ester
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB144.80 | In Stock |
|
| 100G | RMB470.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-97°C |
| Boiling point: | 504.3±50.0 °C(Predicted) |
| Density | 1.219±0.06 g/cm3(Predicted) |
| refractive index | -22.6 ° (C=1, MeOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in dichloromethane |
| pka | 4.09±0.19(Predicted) |
| form | Powder |
| color | White to off-white |
| optical activity | Consistent with structure |
| BRN | 2481680 |
| Major Application | peptide synthesis |
| InChI | 1S/C16H21NO6/c1-16(2,3)23-15(21)17-12(9-13(18)19)14(20)22-10-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,17,21)(H,18,19)/t12-/m0/s1 |
| InChIKey | LDRWTKQWSXGSTM-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(O)=O)C(=O)OCc1ccccc1 |
| CAS DataBase Reference | 30925-18-9(CAS DataBase Reference) |
Description and Uses
N-Boc-L-aspartic acid 1-benzyl ester is used as a local anesthetic and also used in agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |





