A1262712
4,4′-Bis(diethylamino)benzophenone , 99% , 90-93-7
Synonym(s):
p ,p ′-Tetraethyldiaminobenzophenone;4,4′-(Tetraethyldiamino)benzophenone;4,4′-Bis(diethylamino)-benzophenone;4,4′-Bis(diethylamino)diphenyl ketone;Bis[4-(diethylamino)phenyl]methanone
CAS NO.:90-93-7
Empirical Formula: C21H28N2O
Molecular Weight: 324.46
MDL number: MFCD00009044
EINECS: 202-025-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB32.80 | In Stock |
|
| 100G | RMB71.20 | In Stock |
|
| 500G | RMB316.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 89-92 °C(lit.) |
| Boiling point: | 475.7±30.0 °C(Predicted) |
| Density | 1.048±0.06 g/cm3(Predicted) |
| bulk density | 400kg/m3 |
| vapor pressure | 0Pa at 20℃ |
| Flash point: | 151 °C |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.14±0.32(Predicted) |
| form | Crystalline Granules |
| color | Yellow to yellow-green |
| PH | 4-6 (50g/l, H2O, 20℃) |
| Water Solubility | insoluble |
| Sensitive | Light Sensitive |
| λmax | 352nm(THF)(lit.) |
| BRN | 2148611 |
| InChI | 1S/C21H28N2O/c1-5-22(6-2)19-13-9-17(10-14-19)21(24)18-11-15-20(16-12-18)23(7-3)8-4/h9-16H,5-8H2,1-4H3 |
| InChIKey | VYHBFRJRBHMIQZ-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=C(C(C2=CC=C(N(CC)CC)C=C2)=O)C=C1)CC |
| LogP | 5.2 at 35℃ |
| CAS DataBase Reference | 90-93-7(CAS DataBase Reference) |
| EPA Substance Registry System | Methanone, bis[4-(diethylamino)phenyl]- (90-93-7) |
Description and Uses
4,4'-Bis(diethylamino) benzophenone is a highly efficient type II free radical photoinitiator that can initiate polymerization of oligomers under ultraviolet light. In addition, tetraethyl Michler's ketone is also an intermediate in the production of basic brilliant blue dye BO and triphenylmethane chemicals.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H410-H401-H411-H315-H319-H335-H400 |
| Precautionary statements | P280i-P337+P313-P261-P273-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P391-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50/53 |
| Safety Statements | 26-60-61-36-24/25 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | OS9545500 |
| F | 8 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29223990 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | LD50 orally in Rabbit: 5000 mg/kg |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





