A1264850
(2S)-N-Chloroacetyl-2-cyanotetrahydropyrrole , 95% , 207557-35-5
CAS NO.：207557-35-5
Empirical Formula: C7H9ClN2O
Molecular Weight: 172.61
MDL number: MFCD08689902
EINECS: 807-388-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB88.80 | In Stock |
|
| 5g | RMB280.00 | In Stock |
|
| 25g | RMB959.20 | In Stock |
|
| 100g | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-53 °C |
| Boiling point: | 363.1±37.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -4.65±0.40(Predicted) |
| color | Pale Yellow to Light Brown |
| optical activity | Consistent with structure |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H9ClN2O/c8-4-7(11)10-3-1-2-6(10)5-9/h6H,1-4H2/t6-/m0/s1 |
| InChIKey | YCWRPKBYQZOLCD-LURJTMIESA-N |
| SMILES | N1(C(CCl)=O)CCC[C@H]1C#N |
Description and Uses
(2S)-1-(2-Chloroacetyl)-2-9-pyrrolidinecarbonitrile is a key intermediate for dipeptidyl peptidase IV inhibitor Vildagliptin (V305000).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| HS Code | 2933998090 |
