A1268412
Bis(2-ethylhexyl)phosphate , CP , 298-07-7
Synonym(s):
Bis(2-ethylhexyl) hydrogen phosphate;Bis(2-ethylhexyl) phosphate;HDEHP;Di(2-ethylhexyl) phosphate;HDEHP, Phosphoric acid bis (2-ethylhexyl) ester, Bis(2-ethylhexyl) phosphoric acid
CAS NO.:298-07-7
Empirical Formula: C16H35O4P
Molecular Weight: 322.42
MDL number: MFCD00009492
EINECS: 206-056-4
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −60 °C(lit.) |
| Boiling point: | 48 °C (12 mmHg) |
| Density | 0.965 g/mL at 25 °C(lit.) |
| vapor pressure | <0.1 hPa (20 °C) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Store below +30°C. |
| solubility | ethanol: soluble100mg/mL, clear |
| form | Liquid |
| pka | 1.47±0.50(Predicted) |
| Specific Gravity | 0.974 |
| color | Colorless |
| PH | 3 (< 1g/l, H2O) |
| Water Solubility | slightly soluble |
| FreezingPoint | -60℃ |
| BRN | 1712988 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C16H35O4P/c1-5-9-11-15(7-3)13-19-21(17,18)20-14-16(8-4)12-10-6-2/h15-16H,5-14H2,1-4H3,(H,17,18) |
| InChIKey | SEGLCEQVOFDUPX-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COP(O)(=O)OCC(CC)CCCC |
| LogP | 2.88 at 25℃ |
| CAS DataBase Reference | 298-07-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Bis(2-ethylhexyl)hydrogen phosphate(298-07-7) |
| EPA Substance Registry System | Bis(2-ethylhexyl) phosphate (298-07-7) |
| ECETOC JACC REPORT | Bis(2-ethylhexyl) phosphate (298-07-7) |
Description and Uses
Additive to lubrication oils, corrosion inhibitor, and antioxidant. Used as extractant in the hydrometallurgical separation of cobalt and nickel. Metal extraction and separation, intermediate for wetting agents and detergents . Feedstock for chemical synthesis; extraction fluid for metal salts; cation extracting agent.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H312-H314 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 21-34 |
| Safety Statements | 26-36/37/39-45-25 |
| RIDADR | UN 1902 8/PG 3 |
| WGK Germany | 1 |
| RTECS | TB7875000 |
| Autoignition Temperature | 255 °C |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29190090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
| Hazardous Substances Data | 298-07-7(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 4940 mg/kg LD50 dermal Rabbit 1250 mg/kg |






