A1269312
Bis(cyclohexanone)oxalyldihydrazone , AR , 370-81-0
Synonym(s):
Biscyclohexanone oxalyldihydrazone, Cuprizone;Cuprizon;Cuprizone;Oxalic acid bis (cyclohexylidene hydrazide);Oxalic acid bis(cyclohexylidenehydrazide)
CAS NO.:370-81-0
Empirical Formula: C14H22N4O2
Molecular Weight: 278.35
MDL number: MFCD00001659
EINECS: 206-729-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB31.20 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100g | RMB196.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 210-214 °C(lit.) |
| Boiling point: | 421.17°C (rough estimate) |
| Density | 1.0823 (rough estimate) |
| bulk density | 150kg/m3 |
| refractive index | 1.6200 (estimate) |
| storage temp. | 2-8°C |
| solubility | acetic acid: 50mg/mL, colorless to very faintly brown |
| form | Powder |
| pka | 10.78±0.20(Predicted) |
| color | White |
| Water Solubility | Soluble in alcohol. Insoluble in water. |
| BRN | 2388004 |
| InChI | 1S/C14H22N4O2/c19-13(17-15-11-7-3-1-4-8-11)14(20)18-16-12-9-5-2-6-10-12/h1-10H2,(H,17,19)(H,18,20) |
| InChIKey | DSRJIHMZAQEUJV-UHFFFAOYSA-N |
| SMILES | O=C(N\N=C1\CCCCC1)C(=O)N\N=C2/CCCCC2 |
| CAS DataBase Reference | 370-81-0(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanedioic acid, bis(cyclohexylidenehydrazide) (370-81-0) |
Description and Uses
Bis(cyclohexanone) oxaldihydrazone is used in the quantitative spectroscopic determination of copper. It is also essential for the experimental study of mitochondrial metabolism. It is used to study the human demyelinating diseases such as multiple sclerosis and components of neuroinflammation. Further, it acts as ligand and catalyzes Ullmann-type C-N bond forming reactions in the presence of copper salt.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 21/22 |
| Safety Statements | 24/25-2 |
| WGK Germany | 3 |
| RTECS | RO2520000 |
| TSCA | TSCA listed |
| HS Code | 29280090 |
| Storage Class | 11 - Combustible Solids |





