A1271412
Boc-Lys-OH , 98% , 13734-28-6
Synonym(s):
Nα-(tert-Butoxycarbonyl)-L -lysine;Nα-Boc-L -lysine;Boc-Lys-OH;N-α-t.-Boc-L-lysine
CAS NO.:13734-28-6
Empirical Formula: C11H22N2O4
Molecular Weight: 246.3
MDL number: MFCD00038203
EINECS: 237-303-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB64.00 | In Stock |
|
| 25G | RMB234.40 | In Stock |
|
| 100G | RMB849.60 | In Stock |
|
| 500g | RMB4199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~205 °C (dec.)(lit.) |
| alpha | 22 º (c=2, CH3OH) |
| Boiling point: | 389.3°C (rough estimate) |
| Density | 1.1313 (rough estimate) |
| refractive index | 21.5 ° (C=2, MeOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Acetic Acid (Slightly), Methanol (Slightly, Sonicated), Water (Slightly, Heated, |
| pka | 3.92±0.21(Predicted) |
| form | Powder |
| color | White |
| optical activity | [α]20/D +4.6±0.5°, c = 2% in H2O |
| Water Solubility | Soluble in water. Slightly soluble in methanol. |
| BRN | 4252546 |
| Sequence | {Boc-Lys} |
| InChI | InChI=1S/C11H22N2O4/c1-11(2,3)17-10(16)13-8(9(14)15)6-4-5-7-12/h8H,4-7,12H2,1-3H3,(H,13,16)(H,14,15)/t8-/m0/s1 |
| InChIKey | DQUHYEDEGRNAFO-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](CCCCN)NC(OC(C)(C)C)=O |
| CAS DataBase Reference | 13734-28-6(CAS DataBase Reference) |
Description and Uses
Boc-Lys-OH (Nα-Boc-L-lysine) can be used as a building block to synthesize:
A heterotrifunctional peptide-based linker molecule applicable as a bio-labeling reagent.
Lysine derivatives of azamacrocycle and anthraquinone.
Boc-Lys(Bn4-DTPA)-OH, a precursor to synthesize diethylene triamine pentaacetic acid (DTPA) containing peptides.
A ferrocene-amino acid conjugate which is used in developing chemical warfare agent (CWA) sensor.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P302+P352-P362+P364 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 2924 19 00 |
| HazardClass | IRRITANT |







