A1273712
tert-Butyldiphenylchlorosilane , 98% , 58479-61-1
Synonym(s):
tert-Butyldiphenylchlorosilane;TBDPSCl
CAS NO.:58479-61-1
Empirical Formula: C16H19ClSi
Molecular Weight: 274.86
MDL number: MFCD00000497
EINECS: 261-282-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10G | RMB47.20 | In Stock |
|
| 25g | RMB82.40 | In Stock |
|
| 50G | RMB159.20 | In Stock |
|
| 100G | RMB310.40 | In Stock |
|
| 250G | RMB743.20 | In Stock |
|
| 500g | RMB1341.60 | In Stock |
|
| 1kg | RMB2239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 90 °C0.01 mm Hg(lit.) |
| Density | 1.057 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | miscible in most organic solvents. |
| form | Liquid |
| Specific Gravity | 1.074 |
| color | Clear colorless to yellow or slightly brown |
| Water Solubility | reacts |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 644023 |
| InChI | 1S/C16H19ClSi/c1-16(2,3)18(17,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13H,1-3H3 |
| InChIKey | MHYGQXWCZAYSLJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](Cl)(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 58479-61-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Silane, chloro(1,1-dimethylethyl)diphenyl-(58479-61-1) |
| EPA Substance Registry System | Silane, chloro(1,1-dimethylethyl)diphenyl- (58479-61-1) |
Description and Uses
tert-Butylchlorodiphenylsilane can be used to prepare 1-benzyloxy-3-(tert-butyldiphenylsilyloxy)propan-2-ol, a key intermediate for the synthesis of mono-O-protected pyrimidine acyclic nucleosides.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | C,Xi |
| Risk Statements | 14-34-37-29-20/21/22-40 |
| Safety Statements | 26-36/37/39-45-8 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant/Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29310095 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Not Permitted as Excepted Quantity |





