A1274012
2-Bromo-5-fluoropyridine , 99% , 41404-58-4
CAS NO.:41404-58-4
Empirical Formula: C5H3BrFN
Molecular Weight: 175.99
MDL number: MFCD00234011
EINECS: 629-269-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB30.40 | In Stock |
|
| 5G | RMB82.40 | In Stock |
|
| 25g | RMB330.40 | In Stock |
|
| 100G | RMB1153.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30-31 °C (lit.) |
| Boiling point: | 80-83 °C/44 mmHg (lit.) |
| Density | 1.707±0.06 g/cm3(Predicted) |
| refractive index | 1.5396 |
| Flash point: | 167 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -1.63±0.10(Predicted) |
| form | Liquid |
| color | Colorless to slightly yellow |
| BRN | 1561456 |
| InChI | InChI=1S/C5H3BrFN/c6-5-2-1-4(7)3-8-5/h1-3H |
| InChIKey | UODINHBLNPPDPD-UHFFFAOYSA-N |
| SMILES | C1(Br)=NC=C(F)C=C1 |
| CAS DataBase Reference | 41404-58-4(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-fluoropyridine can be used in the synthesis of the following:
- 5-fluoro-2-phenylpyridine via Suzuki coupling reaction with phenylboronic acid
- 5-fluoro-2-(p-tolyl)pyridine via Suzuki coupling reaction with p-tolylboronic acid
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn,F |
| Risk Statements | 36/37/38-20/21/22-10 |
| Safety Statements | 26-36-16 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







