A1276312
N-Boc-L-Valinol , 98% , 79069-14-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB28.00 | In Stock |
|
| 5G | RMB92.00 | In Stock |
|
| 10g | RMB198.40 | In Stock |
|
| 25g | RMB377.60 | In Stock |
|
| 100g | RMB1060.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -23 º (c=1 in chloroform) |
| Boiling point: | 208 °C(lit.) |
| Density | 0.995 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 12.02±0.46(Predicted) |
| Appearance | Colorless to light yellow Oil |
| optical activity | [α]23/D 23°, c = 1 in chloroform |
| BRN | 4663728 |
| Major Application | peptide synthesis |
| InChI | 1S/C10H21NO3/c1-7(2)8(6-12)11-9(13)14-10(3,4)5/h7-8,12H,6H2,1-5H3,(H,11,13)/t8-/m1/s1 |
| InChIKey | OOQRRYDVICNJGC-MRVPVSSYSA-N |
| SMILES | CC(C)[C@@H](CO)NC(=O)OC(C)(C)C |
| CAS DataBase Reference | 79069-14-0(CAS DataBase Reference) |
Description and Uses
Starting material for the synthesis of enantiopure homo-β-amino acids. Used in the efficient synthesis of enantiopure tetrahydroisoquinolines. Intermediate in the one-pot conversion of amino acid carbamates to N-derivatized 2-oxazolidinones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319 |
| Precautionary statements | P210e-P280a-P305+P351+P338-P403+P235-P501a |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 10 - Combustible liquids |






